Products 3008582-86-0
CAS 3008582-86-0 is the registry number for 3-Bromo-6-(difluoromethyl)-2-ethoxypyridine, 96%, 96%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
3-bromo-6-(difluoromethyl)-2-ethoxypyridine (CAS 3008582-86-0) is a chemical compound with the molecular formula C8H8BrF2NO and a molecular weight of 252.06 g/mol. IUPAC name: 3-bromo-6-(difluoromethyl)-2-ethoxypyridine. InChIKey: IWGNTDWKLILBJS-UHFFFAOYSA-N.
| Molecular formula | C8H8BrF2NO |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 3-bromo-6-(difluoromethyl)-2-ethoxypyridine |
| InChIKey | IWGNTDWKLILBJS-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=N1)C(F)F)Br |
Computed by PubChem (NCBI)