Products 30091-54-4
CAS 30091-54-4 is the registry number for 5,6-Dimethyl-3-(2-pyridyl)-1,2,4-triazine. Offered by: Biosynth. Available pack sizes: 0,25g, 0,1g, 0,5g, 1g, 5g.
5,6-dimethyl-3-pyridin-2-yl-1,2,4-triazine (CAS 30091-54-4) is a chemical compound with the molecular formula C10H10N4 and a molecular weight of 186.21 g/mol. IUPAC name: 5,6-dimethyl-3-pyridin-2-yl-1,2,4-triazine. InChIKey: NAFPPMVYCAHBAY-UHFFFAOYSA-N.
| Molecular formula | C10H10N4 |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 5,6-dimethyl-3-pyridin-2-yl-1,2,4-triazine |
| InChIKey | NAFPPMVYCAHBAY-UHFFFAOYSA-N |
| SMILES | CC1=C(N=NC(=N1)C2=CC=CC=N2)C |
Computed by PubChem (NCBI)