Products 301304-67-6
CAS 301304-67-6 is the registry number for Antibacterial agent 227. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (CAS 301304-67-6) is a chemical compound with the molecular formula C12H13N5O3 and a molecular weight of 275.26 g/mol. IUPAC name: 3-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one. InChIKey: OFUZDJSGGHQILN-AWNIVKPZSA-N.
| Molecular formula | C12H13N5O3 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | 3-[(2E)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| InChIKey | OFUZDJSGGHQILN-AWNIVKPZSA-N |
| SMILES | CC1=NN=C(NC1=O)N/N=C/C2=C(C(=CC=C2)OC)O |
Computed by PubChem (NCBI)
Synonyms:
Antibacterial agent 227