CAS 306305-07-7 is the registry number for 4'-Ethynyl-2'-deoxyadenosine. Offered by: TargetMol, Biosynth, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 10mg, Get quote.
(2R,3S,5R)-5-(6-aminopurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol (CAS 306305-07-7) is a chemical compound with the molecular formula C12H13N5O3 and a molecular weight of 275.26 g/mol. IUPAC name: (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol. InChIKey: HMIGVKANVVLEOA-JOAULVNJSA-N.
| Molecular formula | C12H13N5O3 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | (2R,3S,5R)-5-(6-aminopurin-9-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | HMIGVKANVVLEOA-JOAULVNJSA-N |
| SMILES | C#C[C@]1([C@H](C[C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)CO |
Computed by PubChem (NCBI)