Products 301337-46-2

CAS 301337-46-2 is the registry number for 8-Bromo-3-nitro-naphthalene-1-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

8-bromo-3-nitronaphthalene-1-carboxylic acid (CAS 301337-46-2) is a chemical compound with the molecular formula C11H6BrNO4 and a molecular weight of 296.07 g/mol. IUPAC name: 8-bromo-3-nitronaphthalene-1-carboxylic acid. InChIKey: BAJKLNDSGWVZNI-UHFFFAOYSA-N.

Identity
Molecular formulaC11H6BrNO4
Molecular weight296.07 g/mol
IUPAC name8-bromo-3-nitronaphthalene-1-carboxylic acid
InChIKeyBAJKLNDSGWVZNI-UHFFFAOYSA-N
SMILESC1=CC2=CC(=CC(=C2C(=C1)Br)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)