Products 892874-38-3
CAS 892874-38-3 is the registry number for 7-Bromoquinoline-2,3-dicarboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromoquinoline-2,3-dicarboxylic acid (CAS 892874-38-3) is a chemical compound with the molecular formula C11H6BrNO4 and a molecular weight of 296.07 g/mol. IUPAC name: 7-bromoquinoline-2,3-dicarboxylic acid. InChIKey: VAXBHJZBCSBXTC-UHFFFAOYSA-N.
| Molecular formula | C11H6BrNO4 |
|---|---|
| Molecular weight | 296.07 g/mol |
| IUPAC name | 7-bromoquinoline-2,3-dicarboxylic acid |
| InChIKey | VAXBHJZBCSBXTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=NC(=C(C=C21)C(=O)O)C(=O)O)Br |
Computed by PubChem (NCBI)