Products 301527-71-9
CAS 301527-71-9 is the registry number for 2-Amino-n-benzyl-5-fluoro-benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-N-benzyl-5-fluorobenzamide (CAS 301527-71-9) is a chemical compound with the molecular formula C14H13FN2O and a molecular weight of 244.26 g/mol. IUPAC name: 2-amino-N-benzyl-5-fluorobenzamide. InChIKey: SMZUEWRPXQGTOM-UHFFFAOYSA-N.
| Molecular formula | C14H13FN2O |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | 2-amino-N-benzyl-5-fluorobenzamide |
| InChIKey | SMZUEWRPXQGTOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=C(C=CC(=C2)F)N |
Computed by PubChem (NCBI)