Products 926269-33-2
CAS 926269-33-2 appears in our catalog under these names: N-[3-(Aminomethyl)phenyl]-3-fluorobenzamide, 95%, N-(3-(Aminomethyl)phenyl)-3-fluorobenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
N-[3-(aminomethyl)phenyl]-3-fluorobenzamide (CAS 926269-33-2) is a chemical compound with the molecular formula C14H13FN2O and a molecular weight of 244.26 g/mol. IUPAC name: N-[3-(aminomethyl)phenyl]-3-fluorobenzamide. InChIKey: MWIWZKMAVINMGM-UHFFFAOYSA-N.
| Molecular formula | C14H13FN2O |
|---|---|
| Molecular weight | 244.26 g/mol |
| IUPAC name | N-[3-(aminomethyl)phenyl]-3-fluorobenzamide |
| InChIKey | MWIWZKMAVINMGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CC(=CC=C2)F)CN |
Computed by PubChem (NCBI)