CAS 301819-41-0 is the registry number for 2-(2,3-Dioxo-2,3-dihydro-1h-indol-1-yl)-n-(4-methylphenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,3-dioxoindol-1-yl)-N-(4-methylphenyl)acetamide (CAS 301819-41-0) is a chemical compound with the molecular formula C17H14N2O3 and a molecular weight of 294.30 g/mol. IUPAC name: 2-(2,3-dioxoindol-1-yl)-N-(4-methylphenyl)acetamide. InChIKey: XMCXJEBKORLMLB-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O3 |
|---|---|
| Molecular weight | 294.30 g/mol |
| IUPAC name | 2-(2,3-dioxoindol-1-yl)-N-(4-methylphenyl)acetamide |
| InChIKey | XMCXJEBKORLMLB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)CN2C3=CC=CC=C3C(=O)C2=O |
Computed by PubChem (NCBI)