Products 30184-96-4
CAS 30184-96-4 is the registry number for 4,4'-Bis(4-aminophenoxy)benzophenone. Offered by: Biosynth. Available pack sizes: 25g, 50g, 100g, 250g, 500g.
Bis[4-(4-aminophenoxy)phenyl]methanone (CAS 30184-96-4) is a chemical compound with the molecular formula C25H20N2O3 and a molecular weight of 396.4 g/mol. IUPAC name: bis[4-(4-aminophenoxy)phenyl]methanone. InChIKey: LSDYQEILXDCDTR-UHFFFAOYSA-N.
| Molecular formula | C25H20N2O3 |
|---|---|
| Molecular weight | 396.4 g/mol |
| IUPAC name | bis[4-(4-aminophenoxy)phenyl]methanone |
| InChIKey | LSDYQEILXDCDTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)OC3=CC=C(C=C3)N)OC4=CC=C(C=C4)N |
Computed by PubChem (NCBI)