CAS 3019972-01-8 is the registry number for NF-κB-IN-14. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,6-dichloro-9-[(E)-3-(4-methylphenyl)prop-2-enyl]purine (CAS 3019972-01-8) is a chemical compound with the molecular formula C15H12Cl2N4 and a molecular weight of 319.2 g/mol. IUPAC name: 2,6-dichloro-9-[(E)-3-(4-methylphenyl)prop-2-enyl]purine. InChIKey: KQHCRNDNPXTCQH-NSCUHMNNSA-N.
| Molecular formula | C15H12Cl2N4 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | 2,6-dichloro-9-[(E)-3-(4-methylphenyl)prop-2-enyl]purine |
| InChIKey | KQHCRNDNPXTCQH-NSCUHMNNSA-N |
| SMILES | CC1=CC=C(C=C1)/C=C/CN2C=NC3=C2N=C(N=C3Cl)Cl |
Computed by PubChem (NCBI)