CAS 40070-48-2 is the registry number for 7-Chloro-5-(2-chlorophenyl)-2-hydrazinyl-3H-1,4-benzodiazepine. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 25mg, 5mg.
[7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazine (CAS 40070-48-2) is a chemical compound with the molecular formula C15H12Cl2N4 and a molecular weight of 319.2 g/mol. IUPAC name: [7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazine. InChIKey: VTGZNHLCFHSBQH-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2N4 |
|---|---|
| Molecular weight | 319.2 g/mol |
| IUPAC name | [7-chloro-5-(2-chlorophenyl)-3H-1,4-benzodiazepin-2-yl]hydrazine |
| InChIKey | VTGZNHLCFHSBQH-UHFFFAOYSA-N |
| SMILES | C1C(=NC2=C(C=C(C=C2)Cl)C(=N1)C3=CC=CC=C3Cl)NN |
Computed by PubChem (NCBI)