CAS 3024653-17-3 is the registry number for PAR4 antagonist 5. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-6-methoxy-2-(3-methoxy-6-methylcinnolin-8-yl)-1,3-benzothiazole (CAS 3024653-17-3) is a chemical compound with the molecular formula C18H14ClN3O2S and a molecular weight of 371.8 g/mol. IUPAC name: 4-chloro-6-methoxy-2-(3-methoxy-6-methylcinnolin-8-yl)-1,3-benzothiazole. InChIKey: ZAFHORJBQGECAC-UHFFFAOYSA-N.
| Molecular formula | C18H14ClN3O2S |
|---|---|
| Molecular weight | 371.8 g/mol |
| IUPAC name | 4-chloro-6-methoxy-2-(3-methoxy-6-methylcinnolin-8-yl)-1,3-benzothiazole |
| InChIKey | ZAFHORJBQGECAC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC(=NN=C2C(=C1)C3=NC4=C(S3)C=C(C=C4Cl)OC)OC |
Computed by PubChem (NCBI)