Products 51287-57-1
CAS 51287-57-1 is the registry number for Denotivir. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-benzamido-N-(4-chlorophenyl)-3-methyl-1,2-thiazole-4-carboxamide (CAS 51287-57-1) is a chemical compound with the molecular formula C18H14ClN3O2S and a molecular weight of 371.8 g/mol. IUPAC name: 5-benzamido-N-(4-chlorophenyl)-3-methyl-1,2-thiazole-4-carboxamide. InChIKey: ZPBLNADJHWHOEP-UHFFFAOYSA-N.
| Molecular formula | C18H14ClN3O2S |
|---|---|
| Molecular weight | 371.8 g/mol |
| IUPAC name | 5-benzamido-N-(4-chlorophenyl)-3-methyl-1,2-thiazole-4-carboxamide |
| InChIKey | ZPBLNADJHWHOEP-UHFFFAOYSA-N |
| SMILES | CC1=NSC(=C1C(=O)NC2=CC=C(C=C2)Cl)NC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)