CAS 302566-89-8 is the registry number for 5-[(2,4-Dimethylbenzyl)thio]-1,3,4-thiadiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-[(2,4-dimethylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine (CAS 302566-89-8) is a chemical compound with the molecular formula C11H13N3S2 and a molecular weight of 251.4 g/mol. IUPAC name: 5-[(2,4-dimethylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine. InChIKey: ZRMFFRHXTHQLBG-UHFFFAOYSA-N.
| Molecular formula | C11H13N3S2 |
|---|---|
| Molecular weight | 251.4 g/mol |
| IUPAC name | 5-[(2,4-dimethylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-amine |
| InChIKey | ZRMFFRHXTHQLBG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)CSC2=NN=C(S2)N)C |
Computed by PubChem (NCBI)