CAS 380335-66-0 is the registry number for 5-{(4-(propan-2-yl)phenyl)amino}-1,3,4-thiadiazole-2-thiol, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(4-propan-2-ylanilino)-3H-1,3,4-thiadiazole-2-thione (CAS 380335-66-0) is a chemical compound with the molecular formula C11H13N3S2 and a molecular weight of 251.4 g/mol. IUPAC name: 5-(4-propan-2-ylanilino)-3H-1,3,4-thiadiazole-2-thione. InChIKey: JIXKQGPKUYDYPH-UHFFFAOYSA-N.
| Molecular formula | C11H13N3S2 |
|---|---|
| Molecular weight | 251.4 g/mol |
| IUPAC name | 5-(4-propan-2-ylanilino)-3H-1,3,4-thiadiazole-2-thione |
| InChIKey | JIXKQGPKUYDYPH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)NC2=NNC(=S)S2 |
Computed by PubChem (NCBI)