Products 3026676-78-5
CAS 3026676-78-5 is the registry number for tert-butyl 6-amino-6-(cyanomethyl)-2-azaspiro[3.3]heptane-2-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
Tert-butyl 6-amino-6-(cyanomethyl)-2-azaspiro[3.3]heptane-2-carboxylate (CAS 3026676-78-5) is a chemical compound with the molecular formula C13H21N3O2 and a molecular weight of 251.32 g/mol. IUPAC name: tert-butyl 6-amino-6-(cyanomethyl)-2-azaspiro[3.3]heptane-2-carboxylate. InChIKey: NNIYGVLWNVWYIK-UHFFFAOYSA-N.
| Molecular formula | C13H21N3O2 |
|---|---|
| Molecular weight | 251.32 g/mol |
| IUPAC name | tert-butyl 6-amino-6-(cyanomethyl)-2-azaspiro[3.3]heptane-2-carboxylate |
| InChIKey | NNIYGVLWNVWYIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)(CC#N)N |
Computed by PubChem (NCBI)