CAS 3026685-76-4 is the registry number for HIF-1α-IN-7. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-3-(2,2-dimethyl-8-pyridin-3-ylchromen-6-yl)-N-(4-methoxyphenyl)prop-2-enamide (CAS 3026685-76-4) is a chemical compound with the molecular formula C26H24N2O3 and a molecular weight of 412.5 g/mol. IUPAC name: (E)-3-(2,2-dimethyl-8-pyridin-3-ylchromen-6-yl)-N-(4-methoxyphenyl)prop-2-enamide. InChIKey: VPBJTGMLEJTSEK-IZZDOVSWSA-N.
| Molecular formula | C26H24N2O3 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | (E)-3-(2,2-dimethyl-8-pyridin-3-ylchromen-6-yl)-N-(4-methoxyphenyl)prop-2-enamide |
| InChIKey | VPBJTGMLEJTSEK-IZZDOVSWSA-N |
| SMILES | CC1(C=CC2=C(O1)C(=CC(=C2)/C=C/C(=O)NC3=CC=C(C=C3)OC)C4=CN=CC=C4)C |
Computed by PubChem (NCBI)