CAS 333314-79-7 appears in our catalog under these names: HIF1-IN-3 / 99.48% (existing batch purity), HIF1–IN–3, N-((8-Hydroxyquinolin-7-yl)(4-methoxyphenyl)methyl)-3-phenylpropanamide, 98%, 98%, HIF1 agonist-1, 99.11%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 50 mg.
N-[(8-hydroxyquinolin-7-yl)-(4-methoxyphenyl)methyl]-3-phenylpropanamide (CAS 333314-79-7) is a chemical compound with the molecular formula C26H24N2O3 and a molecular weight of 412.5 g/mol. IUPAC name: N-[(8-hydroxyquinolin-7-yl)-(4-methoxyphenyl)methyl]-3-phenylpropanamide. InChIKey: RFCCQJJHFAITGH-UHFFFAOYSA-N.
| Molecular formula | C26H24N2O3 |
|---|---|
| Molecular weight | 412.5 g/mol |
| IUPAC name | N-[(8-hydroxyquinolin-7-yl)-(4-methoxyphenyl)methyl]-3-phenylpropanamide |
| InChIKey | RFCCQJJHFAITGH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=C(C3=C(C=CC=N3)C=C2)O)NC(=O)CCC4=CC=CC=C4 |
Computed by PubChem (NCBI)