Products 3026713-88-9

CAS 3026713-88-9 is the registry number for oxalylbis(4,1-phenylene) bis(oct-7-enoate), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

[4-[2-(4-oct-7-enoyloxyphenyl)-2-oxoacetyl]phenyl] oct-7-enoate (CAS 3026713-88-9) is a chemical compound with the molecular formula C30H34O6 and a molecular weight of 490.6 g/mol. IUPAC name: [4-[2-(4-oct-7-enoyloxyphenyl)-2-oxoacetyl]phenyl] oct-7-enoate. InChIKey: ZIZOQOBPCTWAGC-UHFFFAOYSA-N.

Identity
Molecular formulaC30H34O6
Molecular weight490.6 g/mol
IUPAC name[4-[2-(4-oct-7-enoyloxyphenyl)-2-oxoacetyl]phenyl] oct-7-enoate
InChIKeyZIZOQOBPCTWAGC-UHFFFAOYSA-N
SMILESC=CCCCCCC(=O)OC1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)OC(=O)CCCCCC=C

Computed by PubChem (NCBI)