CAS 56083-16-0 is the registry number for Allyl 2,3,4-tri-O-benzyl a-D-galactopyranoside. Offered by: Biosynth. Available pack sizes: 10g, 5g, 25g, 50g.
[(2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxan-2-yl]methanol (CAS 56083-16-0) is a chemical compound with the molecular formula C30H34O6 and a molecular weight of 490.6 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxan-2-yl]methanol. InChIKey: OHCBJQXERNTLKZ-QBHLCAJUSA-N.
| Molecular formula | C30H34O6 |
|---|---|
| Molecular weight | 490.6 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-3,4,5-tris(phenylmethoxy)-6-prop-2-enoxyoxan-2-yl]methanol |
| InChIKey | OHCBJQXERNTLKZ-QBHLCAJUSA-N |
| SMILES | C=CCO[C@@H]1[C@@H]([C@H]([C@H]([C@H](O1)CO)OCC2=CC=CC=C2)OCC3=CC=CC=C3)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)