Products 3026728-53-7
CAS 3026728-53-7 is the registry number for tert-Butyl 1-(Hydroxymethyl)-2-oxabicyclo[2.1.1]hexane-4-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 1-(hydroxymethyl)-2-oxabicyclo[2.1.1]hexane-4-carboxylate (CAS 3026728-53-7) is a chemical compound with the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl 1-(hydroxymethyl)-2-oxabicyclo[2.1.1]hexane-4-carboxylate. InChIKey: JSHMFDXPQXTWRT-UHFFFAOYSA-N.
| Molecular formula | C11H18O4 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl 1-(hydroxymethyl)-2-oxabicyclo[2.1.1]hexane-4-carboxylate |
| InChIKey | JSHMFDXPQXTWRT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C12CC(C1)(OC2)CO |
Computed by PubChem (NCBI)