CAS 3027515-24-5 is the registry number for VU6067416. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-bromo-3-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indazole (CAS 3027515-24-5) is a chemical compound with the molecular formula C12H12BrN3 and a molecular weight of 278.15 g/mol. IUPAC name: 5-bromo-3-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indazole. InChIKey: OZAHEVLLVSEENQ-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN3 |
|---|---|
| Molecular weight | 278.15 g/mol |
| IUPAC name | 5-bromo-3-(1,2,3,6-tetrahydropyridin-5-yl)-1H-indazole |
| InChIKey | OZAHEVLLVSEENQ-UHFFFAOYSA-N |
| SMILES | C1CNCC(=C1)C2=NNC3=C2C=C(C=C3)Br |
Computed by PubChem (NCBI)