Products 3028129-51-0
CAS 3028129-51-0 appears in our catalog under these names: (1R,3S)-3-((tert-Butoxycarbonyl)amino)cyclopentyl 4-methylbenzenesulfonate, 98%, (1R,3S)-3-((tert-Butoxycarbonyl)amino)cyclopentyl 4-methylbenzenesulfonate, 98%, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g, 5g, 10g, 25g.
[(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 4-methylbenzenesulfonate (CAS 3028129-51-0) is a chemical compound with the molecular formula C17H25NO5S and a molecular weight of 355.5 g/mol. IUPAC name: [(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 4-methylbenzenesulfonate. InChIKey: VPEPRGFAJVWNIL-UONOGXRCSA-N.
| Molecular formula | C17H25NO5S |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | [(1R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl] 4-methylbenzenesulfonate |
| InChIKey | VPEPRGFAJVWNIL-UONOGXRCSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O[C@@H]2CC[C@@H](C2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)