CAS 118811-07-7 appears in our catalog under these names: 1–(tert–Butoxycarbonyl)–4–(p–toluenesulfonyloxy)piperidine, 4-(Toluene-4-sulfonyloxy)-piperidine-1-carboxylic acid tert-butyl ester, 98%, 1-Boc-4-(Tosyloxy)piperidine 98%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 25g, 250mg, 100g, 500g, 1000g.
Tert-butyl 4-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate (CAS 118811-07-7) is a chemical compound with the molecular formula C17H25NO5S and a molecular weight of 355.5 g/mol. IUPAC name: tert-butyl 4-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate. InChIKey: IKOMRHLHPZAEMV-UHFFFAOYSA-N.
| Molecular formula | C17H25NO5S |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | tert-butyl 4-(4-methylphenyl)sulfonyloxypiperidine-1-carboxylate |
| InChIKey | IKOMRHLHPZAEMV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC2CCN(CC2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)