CAS 1391730-27-0 is the registry number for tert-Butyl (3S)-3-({[(4-methylbenzene)sulfonyl]oxy}methyl)pyrrolidine-1-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl (3S)-3-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate (CAS 1391730-27-0) is a chemical compound with the molecular formula C17H25NO5S and a molecular weight of 355.5 g/mol. IUPAC name: tert-butyl (3S)-3-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate. InChIKey: WPYAOABDDALQSO-AWEZNQCLSA-N.
| Molecular formula | C17H25NO5S |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | tert-butyl (3S)-3-[(4-methylphenyl)sulfonyloxymethyl]pyrrolidine-1-carboxylate |
| InChIKey | WPYAOABDDALQSO-AWEZNQCLSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OC[C@H]2CCN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)