CAS 3030-54-4 is the registry number for Benzene-1,3-dithiocarboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzene-1,3-dicarbothioamide (CAS 3030-54-4) is a chemical compound with the molecular formula C8H8N2S2 and a molecular weight of 196.3 g/mol. IUPAC name: benzene-1,3-dicarbothioamide. InChIKey: DJOXZAYSEDLTGM-UHFFFAOYSA-N.
| Molecular formula | C8H8N2S2 |
|---|---|
| Molecular weight | 196.3 g/mol |
| IUPAC name | benzene-1,3-dicarbothioamide |
| InChIKey | DJOXZAYSEDLTGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=S)N)C(=S)N |
Computed by PubChem (NCBI)