CAS 851903-84-9 is the registry number for 2-Amino-7,7a-dihydro-5H-thieno(3,4-b)thiopyran-3-carbonitrile, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
2-amino-7,7a-dihydro-5H-thieno[3,4-b]thiopyran-3-carbonitrile (CAS 851903-84-9) is a chemical compound with the molecular formula C8H8N2S2 and a molecular weight of 196.3 g/mol. IUPAC name: 2-amino-7,7a-dihydro-5H-thieno[3,4-b]thiopyran-3-carbonitrile. InChIKey: RLRJPKJJMWSMDQ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2S2 |
|---|---|
| Molecular weight | 196.3 g/mol |
| IUPAC name | 2-amino-7,7a-dihydro-5H-thieno[3,4-b]thiopyran-3-carbonitrile |
| InChIKey | RLRJPKJJMWSMDQ-UHFFFAOYSA-N |
| SMILES | C1C2C(=CC(=C(S2)N)C#N)CS1 |
Computed by PubChem (NCBI)