Products 3031536-71-4

CAS 3031536-71-4 is the registry number for PRMT5:MEP50 PPI, 98.09%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 50 mg, 5 mg, 10mM/1mL, 25 mg, 10 mg.

Structural formula: {0} (CAS {1})

N'-[3-[(3-ethyl-5-methyl-1,2-oxazol-4-yl)methoxy]benzoyl]quinoline-2-carbohydrazide (CAS 3031536-71-4) is a chemical compound with the molecular formula C24H22N4O4 and a molecular weight of 430.5 g/mol. IUPAC name: N'-[3-[(3-ethyl-5-methyl-1,2-oxazol-4-yl)methoxy]benzoyl]quinoline-2-carbohydrazide. InChIKey: SJWRHQSLYNANNC-UHFFFAOYSA-N.

Identity
Molecular formulaC24H22N4O4
Molecular weight430.5 g/mol
IUPAC nameN'-[3-[(3-ethyl-5-methyl-1,2-oxazol-4-yl)methoxy]benzoyl]quinoline-2-carbohydrazide
InChIKeySJWRHQSLYNANNC-UHFFFAOYSA-N
SMILESCCC1=NOC(=C1COC2=CC=CC(=C2)C(=O)NNC(=O)C3=NC4=CC=CC=C4C=C3)C

Computed by PubChem (NCBI)

Synonyms: orb1744670