CAS 3095032-59-7 is the registry number for LCK degrader-3. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-ethyl-1H-indole-2-carboxamide (CAS 3095032-59-7) is a chemical compound with the molecular formula C24H22N4O4 and a molecular weight of 430.5 g/mol. IUPAC name: N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-ethyl-1H-indole-2-carboxamide. InChIKey: NFVLAEUBTSLMGV-UHFFFAOYSA-N.
| Molecular formula | C24H22N4O4 |
|---|---|
| Molecular weight | 430.5 g/mol |
| IUPAC name | N-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]-3-ethyl-1H-indole-2-carboxamide |
| InChIKey | NFVLAEUBTSLMGV-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC2=CC=CC=C21)C(=O)NC3=CC4=C(C=C3)C(=O)N(C4)C5CCC(=O)NC5=O |
Computed by PubChem (NCBI)