Products 3031711-08-4
CAS 3031711-08-4 is the registry number for 1-(oxetan-3-yl)pyrazolo[3,4-c]pyridin-4-amine, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-(oxetan-3-yl)pyrazolo[5,4-c]pyridin-4-amine (CAS 3031711-08-4) is a chemical compound with the molecular formula C9H10N4O and a molecular weight of 190.20 g/mol. IUPAC name: 1-(oxetan-3-yl)pyrazolo[5,4-c]pyridin-4-amine. InChIKey: MYHOGZNVZLMTKA-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 1-(oxetan-3-yl)pyrazolo[5,4-c]pyridin-4-amine |
| InChIKey | MYHOGZNVZLMTKA-UHFFFAOYSA-N |
| SMILES | C1C(CO1)N2C3=C(C=N2)C(=CN=C3)N |
Computed by PubChem (NCBI)