CAS 30320-28-6 appears in our catalog under these names: 2H-Perfluoro(2-methylpentane), 95%, 2H-Perfluoro(2-Methylpentane). Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 10g.
1,1,1,2,2,3,3,5,5,5-decafluoro-4-(trifluoromethyl)pentane (CAS 30320-28-6) is a chemical compound with the molecular formula C6HF13 and a molecular weight of 320.05 g/mol. IUPAC name: 1,1,1,2,2,3,3,5,5,5-decafluoro-4-(trifluoromethyl)pentane. InChIKey: MEJBVGIZGKKPCW-UHFFFAOYSA-N.
| Molecular formula | C6HF13 |
|---|---|
| Molecular weight | 320.05 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,5,5,5-decafluoro-4-(trifluoromethyl)pentane |
| InChIKey | MEJBVGIZGKKPCW-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)