CAS 355-37-3 appears in our catalog under these names: 1H-Perfluorohexane, 95%, 1H–Tridecafluorohexane, 1H-Tridecafluorohexane, >97.0%(GC). Offered by: Combi-blocks, GLPBio, TCI. Available pack sizes: 25g, 1g, 5g, 100g.
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane (CAS 355-37-3) is a chemical compound with the molecular formula C6HF13 and a molecular weight of 320.05 g/mol. IUPAC name: 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane. InChIKey: XJSRKJAHJGCPGC-UHFFFAOYSA-N.
| Molecular formula | C6HF13 |
|---|---|
| Molecular weight | 320.05 g/mol |
| IUPAC name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluorohexane |
| InChIKey | XJSRKJAHJGCPGC-UHFFFAOYSA-N |
| SMILES | C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)