Products 3032479-15-2
CAS 3032479-15-2 is the registry number for Methyl 4-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 3032479-15-2) is a chemical compound with the molecular formula C15H20BFO5 and a molecular weight of 310.13 g/mol. IUPAC name: methyl 4-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: GVXVBIUAAUMHNA-UHFFFAOYSA-N.
| Molecular formula | C15H20BFO5 |
|---|---|
| Molecular weight | 310.13 g/mol |
| IUPAC name | methyl 4-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | GVXVBIUAAUMHNA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)OC)C(=O)OC |
Computed by PubChem (NCBI)