Products 3032629-25-4
CAS 3032629-25-4 is the registry number for Antitubercular agent-13. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-nitrofuran-2-carboxamide (CAS 3032629-25-4) is a chemical compound with the molecular formula C18H18N4O5 and a molecular weight of 370.4 g/mol. IUPAC name: N-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-nitrofuran-2-carboxamide. InChIKey: GJMQGIOXKFZWFI-UHFFFAOYSA-N.
| Molecular formula | C18H18N4O5 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | N-[[5-(4-tert-butylphenyl)-1,3,4-oxadiazol-2-yl]methyl]-5-nitrofuran-2-carboxamide |
| InChIKey | GJMQGIOXKFZWFI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=NN=C(O2)CNC(=O)C3=CC=C(O3)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Antitubercular agent-13