Products 3032653-03-2
CAS 3032653-03-2 is the registry number for methyl 4-amino-6-chloro-5-fluoro-2-methyl-pyridine-3-carboxylate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 4-amino-6-chloro-5-fluoro-2-methylpyridine-3-carboxylate (CAS 3032653-03-2) is a chemical compound with the molecular formula C8H8ClFN2O2 and a molecular weight of 218.61 g/mol. IUPAC name: methyl 4-amino-6-chloro-5-fluoro-2-methylpyridine-3-carboxylate. InChIKey: FGQXXHYRAMCFOF-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2O2 |
|---|---|
| Molecular weight | 218.61 g/mol |
| IUPAC name | methyl 4-amino-6-chloro-5-fluoro-2-methylpyridine-3-carboxylate |
| InChIKey | FGQXXHYRAMCFOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=N1)Cl)F)N)C(=O)OC |
Computed by PubChem (NCBI)