Products 2131059-69-1
CAS 2131059-69-1 is the registry number for Ethyl 2-amino-6-chloro-5-fluoronicotinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-amino-6-chloro-5-fluoropyridine-3-carboxylate (CAS 2131059-69-1) is a chemical compound with the molecular formula C8H8ClFN2O2 and a molecular weight of 218.61 g/mol. IUPAC name: ethyl 2-amino-6-chloro-5-fluoropyridine-3-carboxylate. InChIKey: ZBETZNJJNHMNDZ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2O2 |
|---|---|
| Molecular weight | 218.61 g/mol |
| IUPAC name | ethyl 2-amino-6-chloro-5-fluoropyridine-3-carboxylate |
| InChIKey | ZBETZNJJNHMNDZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(N=C1N)Cl)F |
Computed by PubChem (NCBI)