Products 1256834-71-5
CAS 1256834-71-5 is the registry number for 5-Chloro-2-fluoro-n-methoxy-n-methyl-3-pyridinecarboxamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
5-chloro-2-fluoro-N-methoxy-N-methylpyridine-3-carboxamide (CAS 1256834-71-5) is a chemical compound with the molecular formula C8H8ClFN2O2 and a molecular weight of 218.61 g/mol. IUPAC name: 5-chloro-2-fluoro-N-methoxy-N-methylpyridine-3-carboxamide. InChIKey: BOJJRHJDXGSMHN-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFN2O2 |
|---|---|
| Molecular weight | 218.61 g/mol |
| IUPAC name | 5-chloro-2-fluoro-N-methoxy-N-methylpyridine-3-carboxamide |
| InChIKey | BOJJRHJDXGSMHN-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C1=C(N=CC(=C1)Cl)F)OC |
Computed by PubChem (NCBI)