CAS 3032966-42-7 is the registry number for GPX4-IN-15, 98.79%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 100 mg, 5 mg, 25 mg, 50 mg.
Methyl 4-(3-chloro-N-(2-chloroacetyl)-4-methoxyanilino)benzoate (CAS 3032966-42-7) is a chemical compound with the molecular formula C17H15Cl2NO4 and a molecular weight of 368.2 g/mol. IUPAC name: methyl 4-(3-chloro-N-(2-chloroacetyl)-4-methoxyanilino)benzoate. InChIKey: HCRRIPLJCLCAQV-UHFFFAOYSA-N.
| Molecular formula | C17H15Cl2NO4 |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | methyl 4-(3-chloro-N-(2-chloroacetyl)-4-methoxyanilino)benzoate |
| InChIKey | HCRRIPLJCLCAQV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)N(C2=CC=C(C=C2)C(=O)OC)C(=O)CCl)Cl |
Computed by PubChem (NCBI)