CAS 85825-42-9 appears in our catalog under these names: Felodipine Metabolite Lactone, Felodipine Ester Lactone, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1mg, 2,5mg, 5mg.
Ethyl 4-(2,3-dichlorophenyl)-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate (CAS 85825-42-9) is a chemical compound with the molecular formula C17H15Cl2NO4 and a molecular weight of 368.2 g/mol. IUPAC name: ethyl 4-(2,3-dichlorophenyl)-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate. InChIKey: OUYRRXPTFNEXQC-UHFFFAOYSA-N.
| Molecular formula | C17H15Cl2NO4 |
|---|---|
| Molecular weight | 368.2 g/mol |
| IUPAC name | ethyl 4-(2,3-dichlorophenyl)-2-methyl-5-oxo-4,7-dihydro-1H-furo[3,4-b]pyridine-3-carboxylate |
| InChIKey | OUYRRXPTFNEXQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC2=C(C1C3=C(C(=CC=C3)Cl)Cl)C(=O)OC2)C |
Computed by PubChem (NCBI)