Products 3033-77-0

CAS 3033-77-0 appears in our catalog under these names: Glycidyltrimethylammonium Chloride (Technical Grade), Glycidyltrimethylammonium Chloride (ca. 80% in Water), Glycidyltrimethylammonium Chloride, Glycidyltrimethylammonium chloride 95%, (2,3-EPOXYPROPYL)TRIMETHYLAMMONIUM CHLORIDE, 95%. Offered by: TRC, TCI, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 500mg, 25g, 100g, 500g, 0,25kg, 0,5kg.

Structural formula: {0} (CAS {1})

Trimethyl(oxiran-2-ylmethyl)azanium chloride (CAS 3033-77-0) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: trimethyl(oxiran-2-ylmethyl)azanium chloride. InChIKey: PUVAFTRIIUSGLK-UHFFFAOYSA-M.

Identity
Molecular formulaC6H14ClNO
Molecular weight151.63 g/mol
IUPAC nametrimethyl(oxiran-2-ylmethyl)azanium chloride
InChIKeyPUVAFTRIIUSGLK-UHFFFAOYSA-M
SMILESC[N+](C)(C)CC1CO1.[Cl-]

Computed by PubChem (NCBI)