Products 3033394-27-0
CAS 3033394-27-0 is the registry number for 1-Methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[d][1,2,3]triazole, 97%. Offered by: Fluorochem. Available pack sizes: 100mg, 250mg.
1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzotriazole (CAS 3033394-27-0) is a chemical compound with the molecular formula C13H18BN3O2 and a molecular weight of 259.11 g/mol. IUPAC name: 1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzotriazole. InChIKey: YQQNYUHLTKZTFK-UHFFFAOYSA-N.
| Molecular formula | C13H18BN3O2 |
|---|---|
| Molecular weight | 259.11 g/mol |
| IUPAC name | 1-methyl-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzotriazole |
| InChIKey | YQQNYUHLTKZTFK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)N=NN3C |
Computed by PubChem (NCBI)