Products 3033744-22-5
CAS 3033744-22-5 appears in our catalog under these names: 4-(4-Bromophenyl)-2,5-dimethyl-2,4-dihydro-3H-1,2,4-triazol-3-one, 95%, 95%, 4-(4-Bromophenyl)-2,5-dimethyl-2,4-dihydro-3H-1,2,4-triazol-3-one, 98%, 4-(4-Bromophenyl)-2,5-dimethyl-2,4-dihydro-3H-1,2,4-triazol-3-one, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g, 25g, 50g.
4-(4-bromophenyl)-2,5-dimethyl-1,2,4-triazol-3-one (CAS 3033744-22-5) is a chemical compound with the molecular formula C10H10BrN3O and a molecular weight of 268.11 g/mol. IUPAC name: 4-(4-bromophenyl)-2,5-dimethyl-1,2,4-triazol-3-one. InChIKey: DHFIZMVBHTWHGB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3O |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 4-(4-bromophenyl)-2,5-dimethyl-1,2,4-triazol-3-one |
| InChIKey | DHFIZMVBHTWHGB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)N1C2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)