Products 3034241-21-6
CAS 3034241-21-6 is the registry number for Methyl (S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate (CAS 3034241-21-6) is a chemical compound with the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. IUPAC name: methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate. InChIKey: RFNAYPCGDTXCOM-WRVKLSGPSA-N.
| Molecular formula | C7H12N2O2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-4-carboxylate |
| InChIKey | RFNAYPCGDTXCOM-WRVKLSGPSA-N |
| SMILES | COC(=O)[C@@H]1C2CC(C2)NN1 |
Computed by PubChem (NCBI)