Products 3034241-23-8
CAS 3034241-23-8 is the registry number for Ethyl (S)-1,2-Di-Boc-1,2,3,6-tetrahydropyridazine-3-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-O,2-O-ditert-butyl 3-O-ethyl (3S)-3,6-dihydropyridazine-1,2,3-tricarboxylate (CAS 3034241-23-8) is a chemical compound with the molecular formula C17H28N2O6 and a molecular weight of 356.4 g/mol. IUPAC name: 1-O,2-O-ditert-butyl 3-O-ethyl (3S)-3,6-dihydropyridazine-1,2,3-tricarboxylate. InChIKey: DDQFBGWIURPESL-LBPRGKRZSA-N.
| Molecular formula | C17H28N2O6 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 1-O,2-O-ditert-butyl 3-O-ethyl (3S)-3,6-dihydropyridazine-1,2,3-tricarboxylate |
| InChIKey | DDQFBGWIURPESL-LBPRGKRZSA-N |
| SMILES | CCOC(=O)[C@@H]1C=CCN(N1C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)