Products 3034241-45-4
CAS 3034241-45-4 is the registry number for 2,3-Di-tert-butyl 4-methyl (S)-2,3-diazabicyclo[3.1.1]heptane-2,3,4-tricarboxylate, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-O,3-O-ditert-butyl 4-O-methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-2,3,4-tricarboxylate (CAS 3034241-45-4) is a chemical compound with the molecular formula C17H28N2O6 and a molecular weight of 356.4 g/mol. IUPAC name: 2-O,3-O-ditert-butyl 4-O-methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-2,3,4-tricarboxylate. InChIKey: BSCVQARAZWLANP-MCIGGMRASA-N.
| Molecular formula | C17H28N2O6 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 2-O,3-O-ditert-butyl 4-O-methyl (4S)-2,3-diazabicyclo[3.1.1]heptane-2,3,4-tricarboxylate |
| InChIKey | BSCVQARAZWLANP-MCIGGMRASA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](C2CC(C2)N1C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)