CAS 30343-33-0 is the registry number for 3-(4-Chloro-2-methylphenoxy)-2-butanone, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
3-(4-chloro-2-methylphenoxy)butan-2-one (CAS 30343-33-0) is a chemical compound with the molecular formula C11H13ClO2 and a molecular weight of 212.67 g/mol. IUPAC name: 3-(4-chloro-2-methylphenoxy)butan-2-one. InChIKey: BKRVWLKXKJUFJJ-UHFFFAOYSA-N.
| Molecular formula | C11H13ClO2 |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 3-(4-chloro-2-methylphenoxy)butan-2-one |
| InChIKey | BKRVWLKXKJUFJJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OC(C)C(=O)C |
Computed by PubChem (NCBI)