CAS 3037993-97-5 is the registry number for PARP1/BRD4-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
5,7-dimethoxy-2-[3-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3H-quinazolin-4-one (CAS 3037993-97-5) is a chemical compound with the molecular formula C25H20N4O4 and a molecular weight of 440.4 g/mol. IUPAC name: 5,7-dimethoxy-2-[3-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3H-quinazolin-4-one. InChIKey: VNFNYBBLPFNLBF-UHFFFAOYSA-N.
| Molecular formula | C25H20N4O4 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | 5,7-dimethoxy-2-[3-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-3H-quinazolin-4-one |
| InChIKey | VNFNYBBLPFNLBF-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)NC(=N2)C3=CC=CC(=C3)CC4=NNC(=O)C5=CC=CC=C54 |
Computed by PubChem (NCBI)