CAS 68016-05-7 appears in our catalog under these names: Pigment red 245, 95%, Pigment Red 245. Offered by: Combi-blocks, MedChemExpress. Available pack sizes: 1g, 5g, Get quote.
4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide (CAS 68016-05-7) is a chemical compound with the molecular formula C25H20N4O4 and a molecular weight of 440.4 g/mol. IUPAC name: 4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide. InChIKey: ZWPGSNPNNSTONK-UHFFFAOYSA-N.
| Molecular formula | C25H20N4O4 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | 4-[(5-carbamoyl-2-methoxyphenyl)diazenyl]-3-hydroxy-N-phenylnaphthalene-2-carboxamide |
| InChIKey | ZWPGSNPNNSTONK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)N)N=NC2=C(C(=CC3=CC=CC=C32)C(=O)NC4=CC=CC=C4)O |
Computed by PubChem (NCBI)