CAS 6410-32-8 appears in our catalog under these names: Pigment red 12, C.I. Pigment red 12. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1g, 2g, 5g, Get quote.
3-hydroxy-4-[(2-methyl-4-nitrophenyl)diazenyl]-N-(2-methylphenyl)naphthalene-2-carboxamide (CAS 6410-32-8) is a chemical compound with the molecular formula C25H20N4O4 and a molecular weight of 440.4 g/mol. IUPAC name: 3-hydroxy-4-[(2-methyl-4-nitrophenyl)diazenyl]-N-(2-methylphenyl)naphthalene-2-carboxamide. InChIKey: KDLDNQQRGJAGIS-UHFFFAOYSA-N.
| Molecular formula | C25H20N4O4 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | 3-hydroxy-4-[(2-methyl-4-nitrophenyl)diazenyl]-N-(2-methylphenyl)naphthalene-2-carboxamide |
| InChIKey | KDLDNQQRGJAGIS-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)C2=CC3=CC=CC=C3C(=C2O)N=NC4=C(C=C(C=C4)[N+](=O)[O-])C |
Computed by PubChem (NCBI)